C23H26N4O2S — CID 18137460
N-[4-[2-[3-(N-ethylanilino)propylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 18137460) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[4-[2-[3-(N-ethylanilino)propylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[3-(N-ethylanilino)propylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18137460 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[4-[2-[3-(N-ethylanilino)propylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCN(CCCNC(=O)Cc1csc(NC(=O)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-2-27(20-12-7-4-8-13-20)15-9-14-24-21(28)16-19-17-30-23(25-19)26-22(29)18-10-5-3-6-11-18/h3-8,10-13,17H,2,9,14-16H2,1H3,(H,24,28)(H,25,26,29) |
| InChIKey | ZMHVGYCJQIFYGT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|