C22H19F3N4O3S — CID 39192369
N-[2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 39192369) has the molecular formula C22H19F3N4O3S and a molecular weight of 476.48 g/mol. Its IUPAC name is N-[2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 39192369 |
| Molecular Formula | C22H19F3N4O3S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[2-[[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3N4O3S/c23-22(24,25)16-8-6-15(7-9-16)19(31)27-11-10-26-18(30)12-17-13-33-21(28-17)29-20(32)14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H,26,30)(H,27,31)(H,28,29,32) |
| InChIKey | SCNJAMVUDXGEJR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|