C22H20F2N4O3S — CID 55706715
3-fluoro-N-[2-[[2-[2-[(2-fluorobenzoyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]-4-methylbenzamide (PubChem CID 55706715) has the molecular formula C22H20F2N4O3S and a molecular weight of 458.49 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[2-[2-[(2-fluorobenzoyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[2-[[2-[2-[(2-fluorobenzoyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55706715 |
| Molecular Formula | C22H20F2N4O3S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-fluoro-N-[2-[[2-[2-[(2-fluorobenzoyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)Cc2csc(NC(=O)c3ccccc3F)n2)cc1F |
| InChI | InChI=1S/C22H20F2N4O3S/c1-13-6-7-14(10-18(13)24)20(30)26-9-8-25-19(29)11-15-12-32-22(27-15)28-21(31)16-4-2-3-5-17(16)23/h2-7,10,12H,8-9,11H2,1H3,(H,25,29)(H,26,30)(H,27,28,31) |
| InChIKey | LAWWVRDCQMQQBZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|