C16H19N3O3S — CID 42208483
N-[4-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 42208483) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[4-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42208483 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[4-[3-(2-methoxyethylamino)-3-oxopropyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | COCCNC(=O)CCc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C16H19N3O3S/c1-22-10-9-17-14(20)8-7-13-11-23-16(18-13)19-15(21)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,17,20)(H,18,19,21) |
| InChIKey | CJGAQFLNDIONLK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|