C20H24N4O4S — CID 4188736
N-cyclopropyl-N-[2-[[4-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide (PubChem CID 4188736) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[[4-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-cyclopropyl-N-[2-[[4-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4188736 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-cyclopropyl-N-[2-[[4-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)Cc1csc(NC(=O)CN(C(=O)c2ccccc2)C2CC2)n1 |
| InChI | InChI=1S/C20H24N4O4S/c1-28-10-9-21-17(25)11-15-13-29-20(22-15)23-18(26)12-24(16-7-8-16)19(27)14-5-3-2-4-6-14/h2-6,13,16H,7-12H2,1H3,(H,21,25)(H,22,23,26) |
| InChIKey | JVVNYIFHYNCSMC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|