C17H21N3O4S — CID 16914887
2-benzamido-N,N-bis(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 16914887) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-benzamido-N,N-bis(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzamido-N,N-bis(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16914887 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-benzamido-N,N-bis(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C17H21N3O4S/c1-23-10-8-20(9-11-24-2)16(22)14-12-25-17(18-14)19-15(21)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H,18,19,21) |
| InChIKey | JQAQWAUOHARSKT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |