C14H14ClN3O3S — CID 46113565
2-[(3-chlorobenzoyl)amino]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 46113565) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[(3-chlorobenzoyl)amino]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3-chlorobenzoyl)amino]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113565 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[(3-chlorobenzoyl)amino]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1csc(NC(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H14ClN3O3S/c1-21-6-5-16-13(20)11-8-22-14(17-11)18-12(19)9-3-2-4-10(15)7-9/h2-4,7-8H,5-6H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | XJAOKGBXWRTZJO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|