C15H15N3O4S — CID 39182218
4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid (PubChem CID 39182218) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 39182218 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3O4S/c19-12(20)7-4-8-16-14(22)11-9-23-15(17-11)18-13(21)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,16,22)(H,19,20)(H,17,18,21) |
| InChIKey | LKDXULOBTTUMJK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|