4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid

C15H15N3O4S — CID 39182218

IUPAC4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid
SMILESO=C(O)CCCNC(=O)c1csc(NC(=O)c2ccccc2)n1
InChIInChI=1S/C15H15N3O4S/c19-12(20)7-4-8-16-14(22)11-9-23-15(17-11)18-13(21)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,16,22)(H,19,20)(H,17,18,21)
InChIKeyLKDXULOBTTUMJK-UHFFFAOYSA-N
MW333.37 g/mol
LogP1.99
Rot. Bonds7

About 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid

4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid (PubChem CID 39182218) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid
PubChem CID39182218
Molecular FormulaC15H15N3O4S
Molecular Weight333.37 g/mol
Exact Mass333.08
IUPAC Name4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid
SMILESO=C(O)CCCNC(=O)c1csc(NC(=O)c2ccccc2)n1
InChIInChI=1S/C15H15N3O4S/c19-12(20)7-4-8-16-14(22)11-9-23-15(17-11)18-13(21)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,16,22)(H,19,20)(H,17,18,21)
InChIKeyLKDXULOBTTUMJK-UHFFFAOYSA-N
XLogP1.99
TPSA108.39 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.37
LogP ≤ 51.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid (CID 39182218) is 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid is O=C(O)CCCNC(=O)c1csc(NC(=O)c2ccccc2)n1.
What is the InChIKey of 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid?
The InChIKey is LKDXULOBTTUMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4S/c19-12(20)7-4-8-16-14(22)11-9-23-15(17-11)18-13(21)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,16,22)(H,19,20)(H,17,18,21).
What are the key properties of 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid?
4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid has a molecular weight of 333.37 g/mol, XLogP of 1.99, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-benzamido-1,3-thiazole-4-carbonyl)amino]butanoic acid is sourced from PubChem (CID 39182218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).