C19H17N3O2S — CID 16914979
2-benzamido-N-(2,6-dimethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 16914979) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-benzamido-N-(2,6-dimethylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(2,6-dimethylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16914979 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-benzamido-N-(2,6-dimethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C19H17N3O2S/c1-12-7-6-8-13(2)16(12)21-18(24)15-11-25-19(20-15)22-17(23)14-9-4-3-5-10-14/h3-11H,1-2H3,(H,21,24)(H,20,22,23) |
| InChIKey | LGWCMAIQNGVHDY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |