C19H14N4O2S2 — CID 16914998
2-benzamido-N-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 16914998) has the molecular formula C19H14N4O2S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-benzamido-N-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16914998 |
| Molecular Formula | C19H14N4O2S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-benzamido-N-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cccc2sc(NC(=O)c3csc(NC(=O)c4ccccc4)n3)nc12 |
| InChI | InChI=1S/C19H14N4O2S2/c1-11-6-5-9-14-15(11)21-19(27-14)23-17(25)13-10-26-18(20-13)22-16(24)12-7-3-2-4-8-12/h2-10H,1H3,(H,20,22,24)(H,21,23,25) |
| InChIKey | NWQIYUREIQOCSD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |