C15H12N2O2S — CID 18126545
2-hydroxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 18126545) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-hydroxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-hydroxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18126545 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-hydroxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1cccc2sc(NC(=O)c3ccccc3O)nc12 |
| InChI | InChI=1S/C15H12N2O2S/c1-9-5-4-8-12-13(9)16-15(20-12)17-14(19)10-6-2-3-7-11(10)18/h2-8,18H,1H3,(H,16,17,19) |
| InChIKey | GMBYMSZAARZOTG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |