C17H14N2O3S — CID 43952216
methyl 2-[(4-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 43952216) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is methyl 2-[(4-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 2-[(4-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 43952216 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | methyl 2-[(4-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)Nc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C17H14N2O3S/c1-10-6-5-9-13-14(10)18-17(23-13)19-15(20)11-7-3-4-8-12(11)16(21)22-2/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | PAUANHICMZTYLN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |