C10H9N3O2S2 — CID 30032355
methyl 2-(carbamothioylamino)-1,3-benzothiazole-4-carboxylate (PubChem CID 30032355) has the molecular formula C10H9N3O2S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 2-(carbamothioylamino)-1,3-benzothiazole-4-carboxylate.
| Compound Name | methyl 2-(carbamothioylamino)-1,3-benzothiazole-4-carboxylate |
|---|---|
| PubChem CID | 30032355 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | methyl 2-(carbamothioylamino)-1,3-benzothiazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2sc(NC(N)=S)nc12 |
| InChI | InChI=1S/C10H9N3O2S2/c1-15-8(14)5-3-2-4-6-7(5)12-10(17-6)13-9(11)16/h2-4H,1H3,(H3,11,12,13,16) |
| InChIKey | NLNCTRZGOVCFLF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|