C16H13N3O3S — CID 78797293
4-N-(4-methoxy-1,3-benzothiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 78797293) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is 4-N-(4-methoxy-1,3-benzothiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-methoxy-1,3-benzothiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 78797293 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-N-(4-methoxy-1,3-benzothiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | COc1cccc2sc(NC(=O)c3ccc(C(N)=O)cc3)nc12 |
| InChI | InChI=1S/C16H13N3O3S/c1-22-11-3-2-4-12-13(11)18-16(23-12)19-15(21)10-7-5-9(6-8-10)14(17)20/h2-8H,1H3,(H2,17,20)(H,18,19,21) |
| InChIKey | RTNNKIIQWQPCOE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |