C17H15N3O4S — CID 173125975
2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazole-4-carboxamide (PubChem CID 173125975) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 173125975 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc3c(C(N)=O)cccc3s2)cc1OC |
| InChI | InChI=1S/C17H15N3O4S/c1-23-11-7-6-9(8-12(11)24-2)16(22)20-17-19-14-10(15(18)21)4-3-5-13(14)25-17/h3-8H,1-2H3,(H2,18,21)(H,19,20,22) |
| InChIKey | UTTLUWZPXUUIMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |