C9H9N3O2S — CID 22283036
(4-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 22283036) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is (4-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | (4-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 22283036 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (4-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1cccc2sc(NC(N)=O)nc12 |
| InChI | InChI=1S/C9H9N3O2S/c1-14-5-3-2-4-6-7(5)11-9(15-6)12-8(10)13/h2-4H,1H3,(H3,10,11,12,13) |
| InChIKey | PPBOQWJWGPQHDD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |