C15H18N4O3S — CID 56808850
1-N-(4-methoxy-1,3-benzothiazol-2-yl)piperidine-1,4-dicarboxamide (PubChem CID 56808850) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-N-(4-methoxy-1,3-benzothiazol-2-yl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(4-methoxy-1,3-benzothiazol-2-yl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56808850 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-N-(4-methoxy-1,3-benzothiazol-2-yl)piperidine-1,4-dicarboxamide |
| SMILES | COc1cccc2sc(NC(=O)N3CCC(C(N)=O)CC3)nc12 |
| InChI | InChI=1S/C15H18N4O3S/c1-22-10-3-2-4-11-12(10)17-14(23-11)18-15(21)19-7-5-9(6-8-19)13(16)20/h2-4,9H,5-8H2,1H3,(H2,16,20)(H,17,18,21) |
| InChIKey | NGCAQLXBBGRKPH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |