C18H23FN4O3S — CID 162675230
4-(18F)fluoro-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide (PubChem CID 162675230) has the molecular formula C18H23FN4O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-(18F)fluoro-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-(18F)fluoro-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 162675230 |
| Molecular Formula | C18H23FN4O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-(18F)fluoro-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)N3CCC([18F])CC3)nc12 |
| InChI | InChI=1S/C18H23FN4O3S/c1-25-14-3-2-13(22-8-10-26-11-9-22)16-15(14)20-17(27-16)21-18(24)23-6-4-12(19)5-7-23/h2-3,12H,4-11H2,1H3,(H,20,21,24)/i19-1 |
| InChIKey | BDQMFCOBESCDSN-AWDFDDCISA-N |
| XLogP | 3.11 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|