C19H25N3O5S — CID 11361800
(4-hydroxycyclohexyl) N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamate (PubChem CID 11361800) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is (4-hydroxycyclohexyl) N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | (4-hydroxycyclohexyl) N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 11361800 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (4-hydroxycyclohexyl) N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamate |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)OC3CCC(O)CC3)nc12 |
| InChI | InChI=1S/C19H25N3O5S/c1-25-15-7-6-14(22-8-10-26-11-9-22)17-16(15)20-18(28-17)21-19(24)27-13-4-2-12(23)3-5-13/h6-7,12-13,23H,2-5,8-11H2,1H3,(H,20,21,24) |
| InChIKey | LOVQLZBVFFQCOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|