C20H28N4O5S — CID 175024604
methyl 6-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamoylamino]hexanoate (PubChem CID 175024604) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is methyl 6-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamoylamino]hexanoate.
| Compound Name | methyl 6-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 175024604 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl 6-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Nc1nc2c(OC)ccc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C20H28N4O5S/c1-27-15-8-7-14(24-10-12-29-13-11-24)18-17(15)22-20(30-18)23-19(26)21-9-5-3-4-6-16(25)28-2/h7-8H,3-6,9-13H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | LZGXMNZSGZRKOL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|