C13H16N4O3S — CID 22283121
(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 22283121) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 22283121 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(N)=O)nc12 |
| InChI | InChI=1S/C13H16N4O3S/c1-19-9-3-2-8(17-4-6-20-7-5-17)11-10(9)15-13(21-11)16-12(14)18/h2-3H,4-7H2,1H3,(H3,14,15,16,18) |
| InChIKey | WSLLTWZNZVTCHN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|