C16H21N3O3S — CID 22283227
N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-2-methylpropanamide (PubChem CID 22283227) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-2-methylpropanamide.
| Compound Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 22283227 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-2-methylpropanamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)C(C)C)nc12 |
| InChI | InChI=1S/C16H21N3O3S/c1-10(2)15(20)18-16-17-13-12(21-3)5-4-11(14(13)23-16)19-6-8-22-9-7-19/h4-5,10H,6-9H2,1-3H3,(H,17,18,20) |
| InChIKey | KVSYNBMSBFIPDB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|