C19H23N5O4S — CID 11553490
2-(methoxymethyl)-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methylimidazole-4-carboxamide (PubChem CID 11553490) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | 2-(methoxymethyl)-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11553490 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-(methoxymethyl)-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methylimidazole-4-carboxamide |
| SMILES | COCc1ncc(C(=O)Nc2nc3c(OC)ccc(N4CCOCC4)c3s2)n1C |
| InChI | InChI=1S/C19H23N5O4S/c1-23-13(10-20-15(23)11-26-2)18(25)22-19-21-16-14(27-3)5-4-12(17(16)29-19)24-6-8-28-9-7-24/h4-5,10H,6-9,11H2,1-3H3,(H,21,22,25) |
| InChIKey | FFTOUGXTFYOGCL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|