C22H28N6O3S — CID 11525354
N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methyl-2-(pyrrolidin-1-ylmethyl)imidazole-4-carboxamide (PubChem CID 11525354) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methyl-2-(pyrrolidin-1-ylmethyl)imidazole-4-carboxamide.
| Compound Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methyl-2-(pyrrolidin-1-ylmethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11525354 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3-methyl-2-(pyrrolidin-1-ylmethyl)imidazole-4-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)c3cnc(CN4CCCC4)n3C)nc12 |
| InChI | InChI=1S/C22H28N6O3S/c1-26-16(13-23-18(26)14-27-7-3-4-8-27)21(29)25-22-24-19-17(30-2)6-5-15(20(19)32-22)28-9-11-31-12-10-28/h5-6,13H,3-4,7-12,14H2,1-2H3,(H,24,25,29) |
| InChIKey | FSVSSNHCYNHBIC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|