C27H33N5O4S — CID 10311603
N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-[[methyl-(2-pyrrolidin-1-ylacetyl)amino]methyl]benzamide (PubChem CID 10311603) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-[[methyl-(2-pyrrolidin-1-ylacetyl)amino]methyl]benzamide.
| Compound Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-[[methyl-(2-pyrrolidin-1-ylacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 10311603 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-[[methyl-(2-pyrrolidin-1-ylacetyl)amino]methyl]benzamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)c3ccc(CN(C)C(=O)CN4CCCC4)cc3)nc12 |
| InChI | InChI=1S/C27H33N5O4S/c1-30(23(33)18-31-11-3-4-12-31)17-19-5-7-20(8-6-19)26(34)29-27-28-24-22(35-2)10-9-21(25(24)37-27)32-13-15-36-16-14-32/h5-10H,3-4,11-18H2,1-2H3,(H,28,29,34) |
| InChIKey | YLFWDYHFTRQZNJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|