C26H27N5O3S — CID 10217629
2-[benzyl(methyl)amino]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide (PubChem CID 10217629) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10217629 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)c3ccnc(N(C)Cc4ccccc4)c3)nc12 |
| InChI | InChI=1S/C26H27N5O3S/c1-30(17-18-6-4-3-5-7-18)22-16-19(10-11-27-22)25(32)29-26-28-23-21(33-2)9-8-20(24(23)35-26)31-12-14-34-15-13-31/h3-11,16H,12-15,17H2,1-2H3,(H,28,29,32) |
| InChIKey | MGHPVBURIJGKJK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|