C23H29N5O4S — CID 10217318
2-[(2-ethoxyethylamino)methyl]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide (PubChem CID 10217318) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-[(2-ethoxyethylamino)methyl]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-[(2-ethoxyethylamino)methyl]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10217318 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[(2-ethoxyethylamino)methyl]-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)pyridine-4-carboxamide |
| SMILES | CCOCCNCc1cc(C(=O)Nc2nc3c(OC)ccc(N4CCOCC4)c3s2)ccn1 |
| InChI | InChI=1S/C23H29N5O4S/c1-3-31-11-8-24-15-17-14-16(6-7-25-17)22(29)27-23-26-20-19(30-2)5-4-18(21(20)33-23)28-9-12-32-13-10-28/h4-7,14,24H,3,8-13,15H2,1-2H3,(H,26,27,29) |
| InChIKey | VEILEBRJPHQWOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|