C22H28N6O4 — CID 154973422
2-(2-ethoxyethylamino)-N-(7-methoxy-4-morpholin-4-yl-1H-benzimidazol-2-yl)pyridine-4-carboxamide (PubChem CID 154973422) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-(2-ethoxyethylamino)-N-(7-methoxy-4-morpholin-4-yl-1H-benzimidazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-(2-ethoxyethylamino)-N-(7-methoxy-4-morpholin-4-yl-1H-benzimidazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 154973422 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-(2-ethoxyethylamino)-N-(7-methoxy-4-morpholin-4-yl-1H-benzimidazol-2-yl)pyridine-4-carboxamide |
| SMILES | CCOCCNc1cc(C(=O)Nc2nc3c(N4CCOCC4)ccc(OC)c3[nH]2)ccn1 |
| InChI | InChI=1S/C22H28N6O4/c1-3-31-11-8-24-18-14-15(6-7-23-18)21(29)27-22-25-19-16(28-9-12-32-13-10-28)4-5-17(30-2)20(19)26-22/h4-7,14H,3,8-13H2,1-2H3,(H,23,24)(H2,25,26,27,29) |
| InChIKey | NKAXXWVYKQZSME-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|