2-(2-ethoxyethylamino)pyridine-4-carboxylic acid

C10H14N2O3 — CID 43591505

IUPAC2-(2-ethoxyethylamino)pyridine-4-carboxylic acid
SMILESCCOCCNc1cc(C(=O)O)ccn1
InChIInChI=1S/C10H14N2O3/c1-2-15-6-5-12-9-7-8(10(13)14)3-4-11-9/h3-4,7H,2,5-6H2,1H3,(H,11,12)(H,13,14)
InChIKeyGDMGHNFVRPFYRT-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.23
Rot. Bonds6

About 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid

2-(2-ethoxyethylamino)pyridine-4-carboxylic acid (PubChem CID 43591505) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(2-ethoxyethylamino)pyridine-4-carboxylic acid
PubChem CID43591505
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-(2-ethoxyethylamino)pyridine-4-carboxylic acid
SMILESCCOCCNc1cc(C(=O)O)ccn1
InChIInChI=1S/C10H14N2O3/c1-2-15-6-5-12-9-7-8(10(13)14)3-4-11-9/h3-4,7H,2,5-6H2,1H3,(H,11,12)(H,13,14)
InChIKeyGDMGHNFVRPFYRT-UHFFFAOYSA-N
XLogP1.23
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-propoxypropylamino)pyridine-4-carboxylic acid
CID 82943913
2-(2-hydroxyethylamino)pyridine-4-carboxylic acid
CID 53408816
2-(4-propan-2-yloxybutylamino)pyridine-4-carboxylic acid
CID 106003867
N-(2-ethoxyethyl)-2-(methylamino)pyridine-4-carboxamide
CID 62185207
2-(2-methylprop-2-enylamino)pyridine-4-carboxylic acid
CID 114617456
2-[2-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carboxylic acid
CID 55219063
2-(4-hydroxypentylamino)pyridine-4-carboxylic acid
CID 106136491
1-[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethylamino]-4-pyridinyl]propan-1-one
CID 169158844
2-(2-pyridin-4-ylethylamino)pyridine-4-carboxylic acid
CID 60903144
2-[bis(2-ethoxyethyl)amino]pyridine-4-carboxylic acid
CID 82960357
2-[2-(2-methylphenyl)ethylamino]pyridine-4-carboxylic acid
CID 112723330
2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]pyridine-4-carboxylic acid
CID 106400845

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid?
The IUPAC name of 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid (CID 43591505) is 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid is CCOCCNc1cc(C(=O)O)ccn1.
What is the InChIKey of 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid?
The InChIKey is GDMGHNFVRPFYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-2-15-6-5-12-9-7-8(10(13)14)3-4-11-9/h3-4,7H,2,5-6H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid?
2-(2-ethoxyethylamino)pyridine-4-carboxylic acid has a molecular weight of 210.23 g/mol, XLogP of 1.23, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethylamino)pyridine-4-carboxylic acid is sourced from PubChem (CID 43591505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).