C11H16N2O3 — CID 106136491
2-(4-hydroxypentylamino)pyridine-4-carboxylic acid (PubChem CID 106136491) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(4-hydroxypentylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-(4-hydroxypentylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106136491 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(4-hydroxypentylamino)pyridine-4-carboxylic acid |
| SMILES | CC(O)CCCNc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C11H16N2O3/c1-8(14)3-2-5-12-10-7-9(11(15)16)4-6-13-10/h4,6-8,14H,2-3,5H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | KORZZGMLMBAINK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|