C11H11N3O2S — CID 55219063
2-[2-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carboxylic acid (PubChem CID 55219063) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 55219063 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[2-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCCc2nccs2)c1 |
| InChI | InChI=1S/C11H11N3O2S/c15-11(16)8-1-3-12-9(7-8)13-4-2-10-14-5-6-17-10/h1,3,5-7H,2,4H2,(H,12,13)(H,15,16) |
| InChIKey | YZPCEGVPRUJUHI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |