C12H11FN2O2S — CID 82539161
2-fluoro-5-[2-(1,3-thiazol-2-yl)ethylamino]benzoic acid (PubChem CID 82539161) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-fluoro-5-[2-(1,3-thiazol-2-yl)ethylamino]benzoic acid.
| Compound Name | 2-fluoro-5-[2-(1,3-thiazol-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 82539161 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-fluoro-5-[2-(1,3-thiazol-2-yl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCCc2nccs2)ccc1F |
| InChI | InChI=1S/C12H11FN2O2S/c13-10-2-1-8(7-9(10)12(16)17)14-4-3-11-15-5-6-18-11/h1-2,5-7,14H,3-4H2,(H,16,17) |
| InChIKey | DIXRMAYFNAKIPF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |