C11H10Cl2N2S — CID 94282162
3,5-dichloro-N-[2-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 94282162) has the molecular formula C11H10Cl2N2S and a molecular weight of 273.19 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 3,5-dichloro-N-[2-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 94282162 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 3,5-dichloro-N-[2-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | Clc1cc(Cl)cc(NCCc2nccs2)c1 |
| InChI | InChI=1S/C11H10Cl2N2S/c12-8-5-9(13)7-10(6-8)14-2-1-11-15-3-4-16-11/h3-7,14H,1-2H2 |
| InChIKey | DQQMOHWTNUOZPW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |