C11H14N4S — CID 106750805
4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2,4-triamine (PubChem CID 106750805) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750805 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCCc2nccs2)cc1N |
| InChI | InChI=1S/C11H14N4S/c12-9-2-1-8(7-10(9)13)14-4-3-11-15-5-6-16-11/h1-2,5-7,14H,3-4,12-13H2 |
| InChIKey | RVKKJKUFKCBRLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|