C11H14N4O2S2 — CID 79466616
2-amino-4-[2-(1,3-thiazol-2-yl)ethylamino]benzenesulfonamide (PubChem CID 79466616) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-amino-4-[2-(1,3-thiazol-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-amino-4-[2-(1,3-thiazol-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 79466616 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-amino-4-[2-(1,3-thiazol-2-yl)ethylamino]benzenesulfonamide |
| SMILES | Nc1cc(NCCc2nccs2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14N4O2S2/c12-9-7-8(1-2-10(9)19(13,16)17)14-4-3-11-15-5-6-18-11/h1-2,5-7,14H,3-4,12H2,(H2,13,16,17) |
| InChIKey | HXPGEKGPZYSGDZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|