C14H19N3OS — CID 55232166
2-propoxy-4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,4-diamine (PubChem CID 55232166) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-propoxy-4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,4-diamine.
| Compound Name | 2-propoxy-4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 55232166 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-propoxy-4-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,4-diamine |
| SMILES | CCCOc1cc(NCCc2nccs2)ccc1N |
| InChI | InChI=1S/C14H19N3OS/c1-2-8-18-13-10-11(3-4-12(13)15)16-6-5-14-17-7-9-19-14/h3-4,7,9-10,16H,2,5-6,8,15H2,1H3 |
| InChIKey | COEOQQMRNSLXBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|