C16H24N2O — CID 106166400
4-N-[2-(cyclopenten-1-yl)ethyl]-2-propoxybenzene-1,4-diamine (PubChem CID 106166400) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-N-[2-(cyclopenten-1-yl)ethyl]-2-propoxybenzene-1,4-diamine.
| Compound Name | 4-N-[2-(cyclopenten-1-yl)ethyl]-2-propoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 106166400 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-N-[2-(cyclopenten-1-yl)ethyl]-2-propoxybenzene-1,4-diamine |
| SMILES | CCCOc1cc(NCCC2=CCCC2)ccc1N |
| InChI | InChI=1S/C16H24N2O/c1-2-11-19-16-12-14(7-8-15(16)17)18-10-9-13-5-3-4-6-13/h5,7-8,12,18H,2-4,6,9-11,17H2,1H3 |
| InChIKey | UPVCWFAYKYPPLJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|