C13H18N2 — CID 106166027
4-N-[2-(cyclopenten-1-yl)ethyl]benzene-1,4-diamine (PubChem CID 106166027) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-N-[2-(cyclopenten-1-yl)ethyl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-(cyclopenten-1-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106166027 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-N-[2-(cyclopenten-1-yl)ethyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCC2=CCCC2)cc1 |
| InChI | InChI=1S/C13H18N2/c14-12-5-7-13(8-6-12)15-10-9-11-3-1-2-4-11/h3,5-8,15H,1-2,4,9-10,14H2 |
| InChIKey | RKVNRWPTHBRXGG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|