C12H15ClN2 — CID 103844205
2-chloro-N-[2-(cyclopenten-1-yl)ethyl]pyridin-4-amine (PubChem CID 103844205) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103844205 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]pyridin-4-amine |
| SMILES | Clc1cc(NCCC2=CCCC2)ccn1 |
| InChI | InChI=1S/C12H15ClN2/c13-12-9-11(6-8-15-12)14-7-5-10-3-1-2-4-10/h3,6,8-9H,1-2,4-5,7H2,(H,14,15) |
| InChIKey | WREKYGHXVRIVFA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|