C19H27N3O — CID 109203991
4-[2-(cyclohexen-1-yl)ethylamino]-N-cyclopentylpyridine-2-carboxamide (PubChem CID 109203991) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-N-cyclopentylpyridine-2-carboxamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-cyclopentylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109203991 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-cyclopentylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(NCCC2=CCCCC2)ccn1 |
| InChI | InChI=1S/C19H27N3O/c23-19(22-16-8-4-5-9-16)18-14-17(11-13-21-18)20-12-10-15-6-2-1-3-7-15/h6,11,13-14,16H,1-5,7-10,12H2,(H,20,21)(H,22,23) |
| InChIKey | ZGWHJUZPIFOIOH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|