C17H23N3O — CID 109202082
4-[2-(cyclohexen-1-yl)ethylamino]-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 109202082) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109202082 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1cc(NCCC2=CCCCC2)ccn1 |
| InChI | InChI=1S/C17H23N3O/c1-2-10-20-17(21)16-13-15(9-12-19-16)18-11-8-14-6-4-3-5-7-14/h2,6,9,12-13H,1,3-5,7-8,10-11H2,(H,18,19)(H,20,21) |
| InChIKey | LXIXHXNZEXGWQC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|