C22H27N3O — CID 109205458
N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylethylamino)pyridine-2-carboxamide (PubChem CID 109205458) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylethylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205458 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylethylamino)pyridine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(NCCc2ccccc2)ccn1 |
| InChI | InChI=1S/C22H27N3O/c26-22(25-15-12-19-9-5-2-6-10-19)21-17-20(13-16-24-21)23-14-11-18-7-3-1-4-8-18/h1,3-4,7-9,13,16-17H,2,5-6,10-12,14-15H2,(H,23,24)(H,25,26) |
| InChIKey | SCNNZTIVIOSKLI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|