C22H28N4O — CID 109364440
6-[2-(cyclohexen-1-yl)ethylamino]-2-methyl-N-(2-phenylethyl)pyrimidine-4-carboxamide (PubChem CID 109364440) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)ethylamino]-2-methyl-N-(2-phenylethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)ethylamino]-2-methyl-N-(2-phenylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364440 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)ethylamino]-2-methyl-N-(2-phenylethyl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCCC2=CCCCC2)cc(C(=O)NCCc2ccccc2)n1 |
| InChI | InChI=1S/C22H28N4O/c1-17-25-20(22(27)24-15-13-19-10-6-3-7-11-19)16-21(26-17)23-14-12-18-8-4-2-5-9-18/h3,6-8,10-11,16H,2,4-5,9,12-15H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | SYSHFWGBWMPHCB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|