C22H26N4O3 — CID 109364544
6-(1,3-benzodioxol-5-ylmethylamino)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109364544) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364544 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCc2ccc3c(c2)OCO3)cc(C(=O)NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C22H26N4O3/c1-15-25-18(22(27)23-10-9-16-5-3-2-4-6-16)12-21(26-15)24-13-17-7-8-19-20(11-17)29-14-28-19/h5,7-8,11-12H,2-4,6,9-10,13-14H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | TVYQXSWSBPYSKD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|