C20H23N3O — CID 109205598
4-[2-(cyclohexen-1-yl)ethylamino]-N-phenylpyridine-2-carboxamide (PubChem CID 109205598) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-N-phenylpyridine-2-carboxamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205598 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N-phenylpyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(NCCC2=CCCCC2)ccn1 |
| InChI | InChI=1S/C20H23N3O/c24-20(23-17-9-5-2-6-10-17)19-15-18(12-14-22-19)21-13-11-16-7-3-1-4-8-16/h2,5-7,9-10,12,14-15H,1,3-4,8,11,13H2,(H,21,22)(H,23,24) |
| InChIKey | MKBYGFRYTANBAC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|