C20H21F2N3O — CID 109205535
N-[2-(cyclohexen-1-yl)ethyl]-4-(2,6-difluoroanilino)pyridine-2-carboxamide (PubChem CID 109205535) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(2,6-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2,6-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205535 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2,6-difluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(Nc2c(F)cccc2F)ccn1 |
| InChI | InChI=1S/C20H21F2N3O/c21-16-7-4-8-17(22)19(16)25-15-10-12-23-18(13-15)20(26)24-11-9-14-5-2-1-3-6-14/h4-5,7-8,10,12-13H,1-3,6,9,11H2,(H,23,25)(H,24,26) |
| InChIKey | LIDLICJWTICSSM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|