C23H27N3O3 — CID 109205527
ethyl 4-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate (PubChem CID 109205527) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109205527 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl 4-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccnc(C(=O)NCCC3=CCCCC3)c2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-2-29-23(28)18-8-10-19(11-9-18)26-20-13-15-24-21(16-20)22(27)25-14-12-17-6-4-3-5-7-17/h6,8-11,13,15-16H,2-5,7,12,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | PITDELCHYNEFSI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|