C14H16ClN3S — CID 133415553
2-chloro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]pyridin-4-amine (PubChem CID 133415553) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 2-chloro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133415553 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-chloro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]pyridin-4-amine |
| SMILES | Clc1cc(NCCc2nc3c(s2)CCCC3)ccn1 |
| InChI | InChI=1S/C14H16ClN3S/c15-13-9-10(5-7-17-13)16-8-6-14-18-11-3-1-2-4-12(11)19-14/h5,7,9H,1-4,6,8H2,(H,16,17) |
| InChIKey | PSTMKGNIPBOJKW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|