C16H19N3O2S — CID 133415389
3-methyl-4-nitro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]aniline (PubChem CID 133415389) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-methyl-4-nitro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]aniline.
| Compound Name | 3-methyl-4-nitro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 133415389 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-methyl-4-nitro-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]aniline |
| SMILES | Cc1cc(NCCc2nc3c(s2)CCCC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O2S/c1-11-10-12(6-7-14(11)19(20)21)17-9-8-16-18-13-4-2-3-5-15(13)22-16/h6-7,10,17H,2-5,8-9H2,1H3 |
| InChIKey | HRVWXFYFSIIDBR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|