C15H19N3 — CID 114152749
2-[2-amino-5-[2-(cyclopenten-1-yl)ethylamino]phenyl]acetonitrile (PubChem CID 114152749) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[2-amino-5-[2-(cyclopenten-1-yl)ethylamino]phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-[2-(cyclopenten-1-yl)ethylamino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 114152749 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-[2-amino-5-[2-(cyclopenten-1-yl)ethylamino]phenyl]acetonitrile |
| SMILES | N#CCc1cc(NCCC2=CCCC2)ccc1N |
| InChI | InChI=1S/C15H19N3/c16-9-7-13-11-14(5-6-15(13)17)18-10-8-12-3-1-2-4-12/h3,5-6,11,18H,1-2,4,7-8,10,17H2 |
| InChIKey | UBOCCPOGWVMKDB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|